About methane;[4-(3-nitro-4-propan-2-yloxyphenyl)phenyl] 4-ethenoxybenzoate
methane;[4-(3-nitro-4-propan-2-yloxyphenyl)phenyl] 4-ethenoxybenzoate (PubChem CID 161299547) has the molecular formula C25H25NO6
and a molecular weight of 435.48 g/mol. Its IUPAC name is methane;[4-(3-nitro-4-propan-2-yloxyphenyl)phenyl] 4-ethenoxybenzoate.
Molecular Properties
| Compound Name | methane;[4-(3-nitro-4-propan-2-yloxyphenyl)phenyl] 4-ethenoxybenzoate |
| PubChem CID | 161299547 |
| Molecular Formula | C25H25NO6 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | methane;[4-(3-nitro-4-propan-2-yloxyphenyl)phenyl] 4-ethenoxybenzoate |
| SMILES | C.C=COc1ccc(C(=O)Oc2ccc(-c3ccc(OC(C)C)c([N+](=O)[O-])c3)cc2)cc1 |
| InChI | InChI=1S/C24H21NO6.CH4/c1-4-29-20-10-7-18(8-11-20)24(26)31-21-12-5-17(6-13-21)19-9-14-23(30-16(2)3)22(15-19)25(27)28;/h4-16H,1H2,2-3H3;1H4 |
| InChIKey | VHKPIMUALBKIAJ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze methane;[4-(3-nitro-4-propan-2-yloxyphenyl)phenyl] 4-ethenoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;[4-(3-nitro-4-propan-2-yloxyphenyl)phenyl] 4-ethenoxybenzoate?
The IUPAC name of methane;[4-(3-nitro-4-propan-2-yloxyphenyl)phenyl] 4-ethenoxybenzoate (CID 161299547) is methane;[4-(3-nitro-4-propan-2-yloxyphenyl)phenyl] 4-ethenoxybenzoate.
What is the SMILES notation for methane;[4-(3-nitro-4-propan-2-yloxyphenyl)phenyl] 4-ethenoxybenzoate?
The canonical SMILES for methane;[4-(3-nitro-4-propan-2-yloxyphenyl)phenyl] 4-ethenoxybenzoate is C.C=COc1ccc(C(=O)Oc2ccc(-c3ccc(OC(C)C)c([N+](=O)[O-])c3)cc2)cc1.
What is the InChIKey of methane;[4-(3-nitro-4-propan-2-yloxyphenyl)phenyl] 4-ethenoxybenzoate?
The InChIKey is VHKPIMUALBKIAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21NO6.CH4/c1-4-29-20-10-7-18(8-11-20)24(26)31-21-12-5-17(6-13-21)19-9-14-23(30-16(2)3)22(15-19)25(27)28;/h4-16H,1H2,2-3H3;1H4.
What are the key properties of methane;[4-(3-nitro-4-propan-2-yloxyphenyl)phenyl] 4-ethenoxybenzoate?
methane;[4-(3-nitro-4-propan-2-yloxyphenyl)phenyl] 4-ethenoxybenzoate has a molecular weight of 435.48 g/mol, XLogP of 6.43, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methane;[4-(3-nitro-4-propan-2-yloxyphenyl)phenyl] 4-ethenoxybenzoate is sourced from PubChem (CID 161299547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).