C25H25NO5 — CID 67203637
[4-[4-(3,3-dimethylbutoxy)-3-nitrophenyl]phenyl] benzoate (PubChem CID 67203637) has the molecular formula C25H25NO5 and a molecular weight of 419.48 g/mol. Its IUPAC name is [4-[4-(3,3-dimethylbutoxy)-3-nitrophenyl]phenyl] benzoate.
| Compound Name | [4-[4-(3,3-dimethylbutoxy)-3-nitrophenyl]phenyl] benzoate |
|---|---|
| PubChem CID | 67203637 |
| Molecular Formula | C25H25NO5 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | [4-[4-(3,3-dimethylbutoxy)-3-nitrophenyl]phenyl] benzoate |
| SMILES | CC(C)(C)CCOc1ccc(-c2ccc(OC(=O)c3ccccc3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H25NO5/c1-25(2,3)15-16-30-23-14-11-20(17-22(23)26(28)29)18-9-12-21(13-10-18)31-24(27)19-7-5-4-6-8-19/h4-14,17H,15-16H2,1-3H3 |
| InChIKey | ZFMGTOVDFQBNQL-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|