C44H60O3Si2 — CID 67784455
4-[2-[4-[4-[[dimethyl(phenyl)silyl]methyl-dimethylsilyl]butyl]phenyl]ethyl]-2-(4-octoxyphenyl)benzoic acid (PubChem CID 67784455) has the molecular formula C44H60O3Si2 and a molecular weight of 693.13 g/mol. Its IUPAC name is 4-[2-[4-[4-[[dimethyl(phenyl)silyl]methyl-dimethylsilyl]butyl]phenyl]ethyl]-2-(4-octoxyphenyl)benzoic acid.
| Compound Name | 4-[2-[4-[4-[[dimethyl(phenyl)silyl]methyl-dimethylsilyl]butyl]phenyl]ethyl]-2-(4-octoxyphenyl)benzoic acid |
|---|---|
| PubChem CID | 67784455 |
| Molecular Formula | C44H60O3Si2 |
| Molecular Weight | 693.13 g/mol |
| Exact Mass | 692.41 |
| IUPAC Name | 4-[2-[4-[4-[[dimethyl(phenyl)silyl]methyl-dimethylsilyl]butyl]phenyl]ethyl]-2-(4-octoxyphenyl)benzoic acid |
| SMILES | CCCCCCCCOc1ccc(-c2cc(CCc3ccc(CCCC[Si](C)(C)C[Si](C)(C)c4ccccc4)cc3)ccc2C(=O)O)cc1 |
| InChI | InChI=1S/C44H60O3Si2/c1-6-7-8-9-10-15-32-47-40-29-27-39(28-30-40)43-34-38(26-31-42(43)44(45)46)25-24-37-22-20-36(21-23-37)17-14-16-33-48(2,3)35-49(4,5)41-18-12-11-13-19-41/h11-13,18-23,26-31,34H,6-10,14-17,24-25,32-33,35H2,1-5H3,(H,45,46) |
| InChIKey | YNXMUOUFMQEFFK-UHFFFAOYSA-N |
| XLogP | 11.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.13 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|