C33H46O3Si2 — CID 67783979
4-[5-[dimethyl(trimethylsilylmethyl)silyl]pentyl]-2-[4-[2-(4-methoxyphenyl)ethyl]phenyl]benzoic acid (PubChem CID 67783979) has the molecular formula C33H46O3Si2 and a molecular weight of 546.90 g/mol. Its IUPAC name is 4-[5-[dimethyl(trimethylsilylmethyl)silyl]pentyl]-2-[4-[2-(4-methoxyphenyl)ethyl]phenyl]benzoic acid.
| Compound Name | 4-[5-[dimethyl(trimethylsilylmethyl)silyl]pentyl]-2-[4-[2-(4-methoxyphenyl)ethyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 67783979 |
| Molecular Formula | C33H46O3Si2 |
| Molecular Weight | 546.90 g/mol |
| Exact Mass | 546.30 |
| IUPAC Name | 4-[5-[dimethyl(trimethylsilylmethyl)silyl]pentyl]-2-[4-[2-(4-methoxyphenyl)ethyl]phenyl]benzoic acid |
| SMILES | COc1ccc(CCc2ccc(-c3cc(CCCCC[Si](C)(C)C[Si](C)(C)C)ccc3C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C33H46O3Si2/c1-36-30-20-15-27(16-21-30)12-11-26-13-18-29(19-14-26)32-24-28(17-22-31(32)33(34)35)10-8-7-9-23-38(5,6)25-37(2,3)4/h13-22,24H,7-12,23,25H2,1-6H3,(H,34,35) |
| InChIKey | HLBOCWGGUJCNPY-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.90 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|