C31H41ClO2Si2 — CID 67784021
2-[4-[2-(4-chlorophenyl)ethyl]phenyl]-4-[4-[dimethyl(trimethylsilylmethyl)silyl]butyl]benzoic acid (PubChem CID 67784021) has the molecular formula C31H41ClO2Si2 and a molecular weight of 537.29 g/mol. Its IUPAC name is 2-[4-[2-(4-chlorophenyl)ethyl]phenyl]-4-[4-[dimethyl(trimethylsilylmethyl)silyl]butyl]benzoic acid.
| Compound Name | 2-[4-[2-(4-chlorophenyl)ethyl]phenyl]-4-[4-[dimethyl(trimethylsilylmethyl)silyl]butyl]benzoic acid |
|---|---|
| PubChem CID | 67784021 |
| Molecular Formula | C31H41ClO2Si2 |
| Molecular Weight | 537.29 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | 2-[4-[2-(4-chlorophenyl)ethyl]phenyl]-4-[4-[dimethyl(trimethylsilylmethyl)silyl]butyl]benzoic acid |
| SMILES | C[Si](C)(C)C[Si](C)(C)CCCCc1ccc(C(=O)O)c(-c2ccc(CCc3ccc(Cl)cc3)cc2)c1 |
| InChI | InChI=1S/C31H41ClO2Si2/c1-35(2,3)23-36(4,5)21-7-6-8-26-15-20-29(31(33)34)30(22-26)27-16-11-24(12-17-27)9-10-25-13-18-28(32)19-14-25/h11-20,22H,6-10,21,23H2,1-5H3,(H,33,34) |
| InChIKey | FOXBXIPYXWOTDR-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.29 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|