About (4-heptoxyphenyl) (2S)-2-[4-[(4S)-4-methylhexoxy]phenoxy]propanoate
(4-heptoxyphenyl) (2S)-2-[4-[(4S)-4-methylhexoxy]phenoxy]propanoate (PubChem CID 70385122) has the molecular formula C29H42O5
and a molecular weight of 470.65 g/mol. Its IUPAC name is (4-heptoxyphenyl) (2S)-2-[4-[(4S)-4-methylhexoxy]phenoxy]propanoate.
Molecular Properties
| Compound Name | (4-heptoxyphenyl) (2S)-2-[4-[(4S)-4-methylhexoxy]phenoxy]propanoate |
| PubChem CID | 70385122 |
| Molecular Formula | C29H42O5 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | (4-heptoxyphenyl) (2S)-2-[4-[(4S)-4-methylhexoxy]phenoxy]propanoate |
| SMILES | CCCCCCCOc1ccc(OC(=O)[C@H](C)Oc2ccc(OCCC[C@@H](C)CC)cc2)cc1 |
| InChI | InChI=1S/C29H42O5/c1-5-7-8-9-10-21-31-25-15-19-28(20-16-25)34-29(30)24(4)33-27-17-13-26(14-18-27)32-22-11-12-23(3)6-2/h13-20,23-24H,5-12,21-22H2,1-4H3/t23-,24-/m0/s1 |
| InChIKey | UHRIJQISEXBPCL-ZEQRLZLVSA-N |
| XLogP | 7.61 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-heptoxyphenyl) (2S)-2-[4-[(4S)-4-methylhexoxy]phenoxy]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-heptoxyphenyl) (2S)-2-[4-[(4S)-4-methylhexoxy]phenoxy]propanoate?
The IUPAC name of (4-heptoxyphenyl) (2S)-2-[4-[(4S)-4-methylhexoxy]phenoxy]propanoate (CID 70385122) is (4-heptoxyphenyl) (2S)-2-[4-[(4S)-4-methylhexoxy]phenoxy]propanoate.
What is the SMILES notation for (4-heptoxyphenyl) (2S)-2-[4-[(4S)-4-methylhexoxy]phenoxy]propanoate?
The canonical SMILES for (4-heptoxyphenyl) (2S)-2-[4-[(4S)-4-methylhexoxy]phenoxy]propanoate is CCCCCCCOc1ccc(OC(=O)[C@H](C)Oc2ccc(OCCC[C@@H](C)CC)cc2)cc1.
What is the InChIKey of (4-heptoxyphenyl) (2S)-2-[4-[(4S)-4-methylhexoxy]phenoxy]propanoate?
The InChIKey is UHRIJQISEXBPCL-ZEQRLZLVSA-N. The full InChI is InChI=1S/C29H42O5/c1-5-7-8-9-10-21-31-25-15-19-28(20-16-25)34-29(30)24(4)33-27-17-13-26(14-18-27)32-22-11-12-23(3)6-2/h13-20,23-24H,5-12,21-22H2,1-4H3/t23-,24-/m0/s1.
What are the key properties of (4-heptoxyphenyl) (2S)-2-[4-[(4S)-4-methylhexoxy]phenoxy]propanoate?
(4-heptoxyphenyl) (2S)-2-[4-[(4S)-4-methylhexoxy]phenoxy]propanoate has a molecular weight of 470.65 g/mol, XLogP of 7.61, 17 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-heptoxyphenyl) (2S)-2-[4-[(4S)-4-methylhexoxy]phenoxy]propanoate is sourced from PubChem (CID 70385122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).