C29H46F2GeN2O2 — CID 59790490
8-[4-[5-[(2R,3R)-2,3-difluorooctoxy]pyrimidin-2-yl]phenoxy]octyl-trimethylgermane (PubChem CID 59790490) has the molecular formula C29H46F2GeN2O2 and a molecular weight of 565.31 g/mol. Its IUPAC name is 8-[4-[5-[(2R,3R)-2,3-difluorooctoxy]pyrimidin-2-yl]phenoxy]octyl-trimethylgermane.
| Compound Name | 8-[4-[5-[(2R,3R)-2,3-difluorooctoxy]pyrimidin-2-yl]phenoxy]octyl-trimethylgermane |
|---|---|
| PubChem CID | 59790490 |
| Molecular Formula | C29H46F2GeN2O2 |
| Molecular Weight | 565.31 g/mol |
| Exact Mass | 566.27 |
| IUPAC Name | 8-[4-[5-[(2R,3R)-2,3-difluorooctoxy]pyrimidin-2-yl]phenoxy]octyl-trimethylgermane |
| SMILES | CCCCC[C@@H](F)[C@H](F)COc1cnc(-c2ccc(OCCCCCCCC[Ge](C)(C)C)cc2)nc1 |
| InChI | InChI=1S/C29H46F2GeN2O2/c1-5-6-11-14-27(30)28(31)23-36-26-21-33-29(34-22-26)24-15-17-25(18-16-24)35-20-13-10-8-7-9-12-19-32(2,3)4/h15-18,21-22,27-28H,5-14,19-20,23H2,1-4H3/t27-,28-/m1/s1 |
| InChIKey | CGJUOIVKLYXTJL-VSGBNLITSA-N |
| XLogP | 8.84 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.31 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|