C25H31ClO2S — CID 173395301
[4-(4-oct-3-enylsulfanylphenyl)phenyl] 2-chloro-3-methylbutanoate (PubChem CID 173395301) has the molecular formula C25H31ClO2S and a molecular weight of 431.04 g/mol. Its IUPAC name is [4-(4-oct-3-enylsulfanylphenyl)phenyl] 2-chloro-3-methylbutanoate.
| Compound Name | [4-(4-oct-3-enylsulfanylphenyl)phenyl] 2-chloro-3-methylbutanoate |
|---|---|
| PubChem CID | 173395301 |
| Molecular Formula | C25H31ClO2S |
| Molecular Weight | 431.04 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | [4-(4-oct-3-enylsulfanylphenyl)phenyl] 2-chloro-3-methylbutanoate |
| SMILES | CCCCC=CCCSc1ccc(-c2ccc(OC(=O)C(Cl)C(C)C)cc2)cc1 |
| InChI | InChI=1S/C25H31ClO2S/c1-4-5-6-7-8-9-18-29-23-16-12-21(13-17-23)20-10-14-22(15-11-20)28-25(27)24(26)19(2)3/h7-8,10-17,19,24H,4-6,9,18H2,1-3H3 |
| InChIKey | NNBHMBYZWJVJOS-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.04 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|