About 1-[4-(4-pentylphenyl)phenoxy]propan-2-yl 3-methylpentanoate
1-[4-(4-pentylphenyl)phenoxy]propan-2-yl 3-methylpentanoate (PubChem CID 19823075) has the molecular formula C26H36O3
and a molecular weight of 396.57 g/mol. Its IUPAC name is 1-[4-(4-pentylphenyl)phenoxy]propan-2-yl 3-methylpentanoate.
Molecular Properties
| Compound Name | 1-[4-(4-pentylphenyl)phenoxy]propan-2-yl 3-methylpentanoate |
| PubChem CID | 19823075 |
| Molecular Formula | C26H36O3 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | 1-[4-(4-pentylphenyl)phenoxy]propan-2-yl 3-methylpentanoate |
| SMILES | CCCCCc1ccc(-c2ccc(OCC(C)OC(=O)CC(C)CC)cc2)cc1 |
| InChI | InChI=1S/C26H36O3/c1-5-7-8-9-22-10-12-23(13-11-22)24-14-16-25(17-15-24)28-19-21(4)29-26(27)18-20(3)6-2/h10-17,20-21H,5-9,18-19H2,1-4H3 |
| InChIKey | UHSHJBLOTYANRK-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(4-pentylphenyl)phenoxy]propan-2-yl 3-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(4-pentylphenyl)phenoxy]propan-2-yl 3-methylpentanoate?
The IUPAC name of 1-[4-(4-pentylphenyl)phenoxy]propan-2-yl 3-methylpentanoate (CID 19823075) is 1-[4-(4-pentylphenyl)phenoxy]propan-2-yl 3-methylpentanoate.
What is the SMILES notation for 1-[4-(4-pentylphenyl)phenoxy]propan-2-yl 3-methylpentanoate?
The canonical SMILES for 1-[4-(4-pentylphenyl)phenoxy]propan-2-yl 3-methylpentanoate is CCCCCc1ccc(-c2ccc(OCC(C)OC(=O)CC(C)CC)cc2)cc1.
What is the InChIKey of 1-[4-(4-pentylphenyl)phenoxy]propan-2-yl 3-methylpentanoate?
The InChIKey is UHSHJBLOTYANRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H36O3/c1-5-7-8-9-22-10-12-23(13-11-22)24-14-16-25(17-15-24)28-19-21(4)29-26(27)18-20(3)6-2/h10-17,20-21H,5-9,18-19H2,1-4H3.
What are the key properties of 1-[4-(4-pentylphenyl)phenoxy]propan-2-yl 3-methylpentanoate?
1-[4-(4-pentylphenyl)phenoxy]propan-2-yl 3-methylpentanoate has a molecular weight of 396.57 g/mol, XLogP of 6.83, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(4-pentylphenyl)phenoxy]propan-2-yl 3-methylpentanoate is sourced from PubChem (CID 19823075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).