C34H45FN2O3 — CID 54354358
1-[4-[4-(5-decylpyrimidin-2-yl)phenyl]phenoxy]propan-2-yl 3-fluoropentanoate (PubChem CID 54354358) has the molecular formula C34H45FN2O3 and a molecular weight of 548.74 g/mol. Its IUPAC name is 1-[4-[4-(5-decylpyrimidin-2-yl)phenyl]phenoxy]propan-2-yl 3-fluoropentanoate.
| Compound Name | 1-[4-[4-(5-decylpyrimidin-2-yl)phenyl]phenoxy]propan-2-yl 3-fluoropentanoate |
|---|---|
| PubChem CID | 54354358 |
| Molecular Formula | C34H45FN2O3 |
| Molecular Weight | 548.74 g/mol |
| Exact Mass | 548.34 |
| IUPAC Name | 1-[4-[4-(5-decylpyrimidin-2-yl)phenyl]phenoxy]propan-2-yl 3-fluoropentanoate |
| SMILES | CCCCCCCCCCc1cnc(-c2ccc(-c3ccc(OCC(C)OC(=O)CC(F)CC)cc3)cc2)nc1 |
| InChI | InChI=1S/C34H45FN2O3/c1-4-6-7-8-9-10-11-12-13-27-23-36-34(37-24-27)30-16-14-28(15-17-30)29-18-20-32(21-19-29)39-25-26(3)40-33(38)22-31(35)5-2/h14-21,23-24,26,31H,4-13,22,25H2,1-3H3 |
| InChIKey | UIBFRXAXEGUFSH-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.74 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|