C31H39ClN2O3 — CID 70423212
[4-[4-(5-heptylpyrimidin-2-yl)phenyl]phenyl] (3R)-3-(2-chlorobutoxy)butanoate (PubChem CID 70423212) has the molecular formula C31H39ClN2O3 and a molecular weight of 523.12 g/mol. Its IUPAC name is [4-[4-(5-heptylpyrimidin-2-yl)phenyl]phenyl] (3R)-3-(2-chlorobutoxy)butanoate.
| Compound Name | [4-[4-(5-heptylpyrimidin-2-yl)phenyl]phenyl] (3R)-3-(2-chlorobutoxy)butanoate |
|---|---|
| PubChem CID | 70423212 |
| Molecular Formula | C31H39ClN2O3 |
| Molecular Weight | 523.12 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | [4-[4-(5-heptylpyrimidin-2-yl)phenyl]phenyl] (3R)-3-(2-chlorobutoxy)butanoate |
| SMILES | CCCCCCCc1cnc(-c2ccc(-c3ccc(OC(=O)C[C@@H](C)OCC(Cl)CC)cc3)cc2)nc1 |
| InChI | InChI=1S/C31H39ClN2O3/c1-4-6-7-8-9-10-24-20-33-31(34-21-24)27-13-11-25(12-14-27)26-15-17-29(18-16-26)37-30(35)19-23(3)36-22-28(32)5-2/h11-18,20-21,23,28H,4-10,19,22H2,1-3H3/t23-,28?/m1/s1 |
| InChIKey | QFRSSVJSLKJXQT-YFIOFSHDSA-N |
| XLogP | 8.04 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.12 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|