C25H32F3NO2 — CID 139786550
[4-(5-butyl-2-pyridinyl)phenyl] 3-(trifluoromethyl)nonanoate (PubChem CID 139786550) has the molecular formula C25H32F3NO2 and a molecular weight of 435.53 g/mol. Its IUPAC name is [4-(5-butyl-2-pyridinyl)phenyl] 3-(trifluoromethyl)nonanoate.
| Compound Name | [4-(5-butyl-2-pyridinyl)phenyl] 3-(trifluoromethyl)nonanoate |
|---|---|
| PubChem CID | 139786550 |
| Molecular Formula | C25H32F3NO2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | [4-(5-butyl-2-pyridinyl)phenyl] 3-(trifluoromethyl)nonanoate |
| SMILES | CCCCCCC(CC(=O)Oc1ccc(-c2ccc(CCCC)cn2)cc1)C(F)(F)F |
| InChI | InChI=1S/C25H32F3NO2/c1-3-5-7-8-10-21(25(26,27)28)17-24(30)31-22-14-12-20(13-15-22)23-16-11-19(18-29-23)9-6-4-2/h11-16,18,21H,3-10,17H2,1-2H3 |
| InChIKey | OXJHFXVLCCFCAI-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|