C32H46F3NO2 — CID 139786514
3-(trifluoromethyl)nonyl 4-(5-decyl-2-pyridinyl)benzoate (PubChem CID 139786514) has the molecular formula C32H46F3NO2 and a molecular weight of 533.72 g/mol. Its IUPAC name is 3-(trifluoromethyl)nonyl 4-(5-decyl-2-pyridinyl)benzoate.
| Compound Name | 3-(trifluoromethyl)nonyl 4-(5-decyl-2-pyridinyl)benzoate |
|---|---|
| PubChem CID | 139786514 |
| Molecular Formula | C32H46F3NO2 |
| Molecular Weight | 533.72 g/mol |
| Exact Mass | 533.35 |
| IUPAC Name | 3-(trifluoromethyl)nonyl 4-(5-decyl-2-pyridinyl)benzoate |
| SMILES | CCCCCCCCCCc1ccc(-c2ccc(C(=O)OCCC(CCCCCC)C(F)(F)F)cc2)nc1 |
| InChI | InChI=1S/C32H46F3NO2/c1-3-5-7-9-10-11-12-13-15-26-17-22-30(36-25-26)27-18-20-28(21-19-27)31(37)38-24-23-29(32(33,34)35)16-14-8-6-4-2/h17-22,25,29H,3-16,23-24H2,1-2H3 |
| InChIKey | FUOJUPNXGKDRFT-UHFFFAOYSA-N |
| XLogP | 10.13 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.72 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|