C33H38ClFO5 — CID 102342065
[2-chloro-4-(2-methylbutoxycarbonyl)phenyl] 2-fluoro-4-(4-octoxyphenyl)benzoate (PubChem CID 102342065) has the molecular formula C33H38ClFO5 and a molecular weight of 569.11 g/mol. Its IUPAC name is [2-chloro-4-(2-methylbutoxycarbonyl)phenyl] 2-fluoro-4-(4-octoxyphenyl)benzoate.
| Compound Name | [2-chloro-4-(2-methylbutoxycarbonyl)phenyl] 2-fluoro-4-(4-octoxyphenyl)benzoate |
|---|---|
| PubChem CID | 102342065 |
| Molecular Formula | C33H38ClFO5 |
| Molecular Weight | 569.11 g/mol |
| Exact Mass | 568.24 |
| IUPAC Name | [2-chloro-4-(2-methylbutoxycarbonyl)phenyl] 2-fluoro-4-(4-octoxyphenyl)benzoate |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(C(=O)OCC(C)CC)cc3Cl)c(F)c2)cc1 |
| InChI | InChI=1S/C33H38ClFO5/c1-4-6-7-8-9-10-19-38-27-15-11-24(12-16-27)25-13-17-28(30(35)21-25)33(37)40-31-18-14-26(20-29(31)34)32(36)39-22-23(3)5-2/h11-18,20-21,23H,4-10,19,22H2,1-3H3 |
| InChIKey | CNZCRNGOOWUWOO-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.11 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|