About [4-[5-(5-methylheptyl)pyrimidin-2-yl]phenyl] 4-oct-1-enoxybenzoate
[4-[5-(5-methylheptyl)pyrimidin-2-yl]phenyl] 4-oct-1-enoxybenzoate (PubChem CID 67948533) has the molecular formula C33H42N2O3
and a molecular weight of 514.71 g/mol. Its IUPAC name is [4-[5-(5-methylheptyl)pyrimidin-2-yl]phenyl] 4-oct-1-enoxybenzoate.
Molecular Properties
| Compound Name | [4-[5-(5-methylheptyl)pyrimidin-2-yl]phenyl] 4-oct-1-enoxybenzoate |
| PubChem CID | 67948533 |
| Molecular Formula | C33H42N2O3 |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.32 |
| IUPAC Name | [4-[5-(5-methylheptyl)pyrimidin-2-yl]phenyl] 4-oct-1-enoxybenzoate |
| SMILES | CCCCCCC=COc1ccc(C(=O)Oc2ccc(-c3ncc(CCCCC(C)CC)cn3)cc2)cc1 |
| InChI | InChI=1S/C33H42N2O3/c1-4-6-7-8-9-12-23-37-30-19-17-29(18-20-30)33(36)38-31-21-15-28(16-22-31)32-34-24-27(25-35-32)14-11-10-13-26(3)5-2/h12,15-26H,4-11,13-14H2,1-3H3 |
| InChIKey | BDNKADWQWQJAMV-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[5-(5-methylheptyl)pyrimidin-2-yl]phenyl] 4-oct-1-enoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[5-(5-methylheptyl)pyrimidin-2-yl]phenyl] 4-oct-1-enoxybenzoate?
The IUPAC name of [4-[5-(5-methylheptyl)pyrimidin-2-yl]phenyl] 4-oct-1-enoxybenzoate (CID 67948533) is [4-[5-(5-methylheptyl)pyrimidin-2-yl]phenyl] 4-oct-1-enoxybenzoate.
What is the SMILES notation for [4-[5-(5-methylheptyl)pyrimidin-2-yl]phenyl] 4-oct-1-enoxybenzoate?
The canonical SMILES for [4-[5-(5-methylheptyl)pyrimidin-2-yl]phenyl] 4-oct-1-enoxybenzoate is CCCCCCC=COc1ccc(C(=O)Oc2ccc(-c3ncc(CCCCC(C)CC)cn3)cc2)cc1.
What is the InChIKey of [4-[5-(5-methylheptyl)pyrimidin-2-yl]phenyl] 4-oct-1-enoxybenzoate?
The InChIKey is BDNKADWQWQJAMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H42N2O3/c1-4-6-7-8-9-12-23-37-30-19-17-29(18-20-30)33(36)38-31-21-15-28(16-22-31)32-34-24-27(25-35-32)14-11-10-13-26(3)5-2/h12,15-26H,4-11,13-14H2,1-3H3.
What are the key properties of [4-[5-(5-methylheptyl)pyrimidin-2-yl]phenyl] 4-oct-1-enoxybenzoate?
[4-[5-(5-methylheptyl)pyrimidin-2-yl]phenyl] 4-oct-1-enoxybenzoate has a molecular weight of 514.71 g/mol, XLogP of 8.98, 16 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[5-(5-methylheptyl)pyrimidin-2-yl]phenyl] 4-oct-1-enoxybenzoate is sourced from PubChem (CID 67948533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).