C20H25F5O4 — CID 139777167
2,2,3,3,3-pentafluoropropyl 4-decanoyloxybenzoate (PubChem CID 139777167) has the molecular formula C20H25F5O4 and a molecular weight of 424.41 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoropropyl 4-decanoyloxybenzoate.
| Compound Name | 2,2,3,3,3-pentafluoropropyl 4-decanoyloxybenzoate |
|---|---|
| PubChem CID | 139777167 |
| Molecular Formula | C20H25F5O4 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 2,2,3,3,3-pentafluoropropyl 4-decanoyloxybenzoate |
| SMILES | CCCCCCCCCC(=O)Oc1ccc(C(=O)OCC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H25F5O4/c1-2-3-4-5-6-7-8-9-17(26)29-16-12-10-15(11-13-16)18(27)28-14-19(21,22)20(23,24)25/h10-13H,2-9,14H2,1H3 |
| InChIKey | HFYCABYVBYGZFM-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|