C33H30F3NO7 — CID 139569566
[4-[(E)-3-[2-[4-[methyl-[(Z)-4-oxobut-2-enoyl]amino]phenyl]ethoxy]-3-oxoprop-1-enyl]phenyl] 4-(4,4,4-trifluorobutoxy)benzoate (PubChem CID 139569566) has the molecular formula C33H30F3NO7 and a molecular weight of 609.60 g/mol. Its IUPAC name is [4-[(E)-3-[2-[4-[methyl-[(Z)-4-oxobut-2-enoyl]amino]phenyl]ethoxy]-3-oxoprop-1-enyl]phenyl] 4-(4,4,4-trifluorobutoxy)benzoate.
| Compound Name | [4-[(E)-3-[2-[4-[methyl-[(Z)-4-oxobut-2-enoyl]amino]phenyl]ethoxy]-3-oxoprop-1-enyl]phenyl] 4-(4,4,4-trifluorobutoxy)benzoate |
|---|---|
| PubChem CID | 139569566 |
| Molecular Formula | C33H30F3NO7 |
| Molecular Weight | 609.60 g/mol |
| Exact Mass | 609.20 |
| IUPAC Name | [4-[(E)-3-[2-[4-[methyl-[(Z)-4-oxobut-2-enoyl]amino]phenyl]ethoxy]-3-oxoprop-1-enyl]phenyl] 4-(4,4,4-trifluorobutoxy)benzoate |
| SMILES | CN(C(=O)/C=C\C=O)c1ccc(CCOC(=O)/C=C/c2ccc(OC(=O)c3ccc(OCCCC(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C33H30F3NO7/c1-37(30(39)4-2-21-38)27-12-5-25(6-13-27)19-23-43-31(40)18-9-24-7-14-29(15-8-24)44-32(41)26-10-16-28(17-11-26)42-22-3-20-33(34,35)36/h2,4-18,21H,3,19-20,22-23H2,1H3/b4-2-,18-9+ |
| InChIKey | XFEGLBOHVNMRMI-CLDYRXSUSA-N |
| XLogP | 6.14 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.60 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|