C27H29F3O7 — CID 145345604
2-methoxyethyl 2-methylprop-2-enoate;[4-[(E)-3-oxoprop-1-enyl]phenyl] 4-(4,4,4-trifluorobutoxy)benzoate (PubChem CID 145345604) has the molecular formula C27H29F3O7 and a molecular weight of 522.52 g/mol. Its IUPAC name is 2-methoxyethyl 2-methylprop-2-enoate;[4-[(E)-3-oxoprop-1-enyl]phenyl] 4-(4,4,4-trifluorobutoxy)benzoate.
| Compound Name | 2-methoxyethyl 2-methylprop-2-enoate;[4-[(E)-3-oxoprop-1-enyl]phenyl] 4-(4,4,4-trifluorobutoxy)benzoate |
|---|---|
| PubChem CID | 145345604 |
| Molecular Formula | C27H29F3O7 |
| Molecular Weight | 522.52 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | 2-methoxyethyl 2-methylprop-2-enoate;[4-[(E)-3-oxoprop-1-enyl]phenyl] 4-(4,4,4-trifluorobutoxy)benzoate |
| SMILES | C=C(C)C(=O)OCCOC.O=C/C=C/c1ccc(OC(=O)c2ccc(OCCCC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H17F3O4.C7H12O3/c21-20(22,23)12-2-14-26-17-10-6-16(7-11-17)19(25)27-18-8-4-15(5-9-18)3-1-13-24;1-6(2)7(8)10-5-4-9-3/h1,3-11,13H,2,12,14H2;1,4-5H2,2-3H3/b3-1+; |
| InChIKey | HOQZDEMPYZJASS-KSMVGCCESA-N |
| XLogP | 5.59 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.52 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|