C36H26F3NO9 — CID 146209635
[4-[4-[(E)-3-[4-[methyl-[(Z)-4-oxobut-2-enoyl]amino]phenoxy]-3-oxoprop-1-enyl]phenoxy]carbonylphenyl] 4-(2,2,2-trifluoroethoxy)benzoate (PubChem CID 146209635) has the molecular formula C36H26F3NO9 and a molecular weight of 673.60 g/mol. Its IUPAC name is [4-[4-[(E)-3-[4-[methyl-[(Z)-4-oxobut-2-enoyl]amino]phenoxy]-3-oxoprop-1-enyl]phenoxy]carbonylphenyl] 4-(2,2,2-trifluoroethoxy)benzoate.
| Compound Name | [4-[4-[(E)-3-[4-[methyl-[(Z)-4-oxobut-2-enoyl]amino]phenoxy]-3-oxoprop-1-enyl]phenoxy]carbonylphenyl] 4-(2,2,2-trifluoroethoxy)benzoate |
|---|---|
| PubChem CID | 146209635 |
| Molecular Formula | C36H26F3NO9 |
| Molecular Weight | 673.60 g/mol |
| Exact Mass | 673.16 |
| IUPAC Name | [4-[4-[(E)-3-[4-[methyl-[(Z)-4-oxobut-2-enoyl]amino]phenoxy]-3-oxoprop-1-enyl]phenoxy]carbonylphenyl] 4-(2,2,2-trifluoroethoxy)benzoate |
| SMILES | CN(C(=O)/C=C\C=O)c1ccc(OC(=O)/C=C/c2ccc(OC(=O)c3ccc(OC(=O)c4ccc(OCC(F)(F)F)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C36H26F3NO9/c1-40(32(42)3-2-22-41)27-11-19-29(20-12-27)47-33(43)21-6-24-4-13-30(14-5-24)48-35(45)26-9-17-31(18-10-26)49-34(44)25-7-15-28(16-8-25)46-23-36(37,38)39/h2-22H,23H2,1H3/b3-2-,21-6+ |
| InChIKey | ZCQOYSMLDJVYAC-ZHZAYDEWSA-N |
| XLogP | 6.40 |
| TPSA | 125.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.60 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|