C16H16N2O3 — CID 174686439
3-[4-[(2,4-diaminophenyl)methoxy]phenyl]prop-2-enoic acid (PubChem CID 174686439) has the molecular formula C16H16N2O3 and a molecular weight of 284.32 g/mol. Its IUPAC name is 3-[4-[(2,4-diaminophenyl)methoxy]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[(2,4-diaminophenyl)methoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 174686439 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 3-[4-[(2,4-diaminophenyl)methoxy]phenyl]prop-2-enoic acid |
| SMILES | Nc1ccc(COc2ccc(C=CC(=O)O)cc2)c(N)c1 |
| InChI | InChI=1S/C16H16N2O3/c17-13-5-4-12(15(18)9-13)10-21-14-6-1-11(2-7-14)3-8-16(19)20/h1-9H,10,17-18H2,(H,19,20) |
| InChIKey | RCJVKMBHMHMBGF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|