C17H16N4O2 — CID 90065988
[4-[(E)-3-[(2,4-diaminophenyl)methylamino]-3-oxoprop-1-enyl]phenyl] cyanate (PubChem CID 90065988) has the molecular formula C17H16N4O2 and a molecular weight of 308.34 g/mol. Its IUPAC name is [4-[(E)-3-[(2,4-diaminophenyl)methylamino]-3-oxoprop-1-enyl]phenyl] cyanate.
| Compound Name | [4-[(E)-3-[(2,4-diaminophenyl)methylamino]-3-oxoprop-1-enyl]phenyl] cyanate |
|---|---|
| PubChem CID | 90065988 |
| Molecular Formula | C17H16N4O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | [4-[(E)-3-[(2,4-diaminophenyl)methylamino]-3-oxoprop-1-enyl]phenyl] cyanate |
| SMILES | N#COc1ccc(/C=C/C(=O)NCc2ccc(N)cc2N)cc1 |
| InChI | InChI=1S/C17H16N4O2/c18-11-23-15-6-1-12(2-7-15)3-8-17(22)21-10-13-4-5-14(19)9-16(13)20/h1-9H,10,19-20H2,(H,21,22)/b8-3+ |
| InChIKey | JXIPBLJSXSIJCZ-FPYGCLRLSA-N |
| XLogP | 2.04 |
| TPSA | 114.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|