C18H17N3O3 — CID 90065998
2-(3,5-diaminophenyl)ethyl (E)-3-(4-cyanatophenyl)prop-2-enoate (PubChem CID 90065998) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is 2-(3,5-diaminophenyl)ethyl (E)-3-(4-cyanatophenyl)prop-2-enoate.
| Compound Name | 2-(3,5-diaminophenyl)ethyl (E)-3-(4-cyanatophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 90065998 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 2-(3,5-diaminophenyl)ethyl (E)-3-(4-cyanatophenyl)prop-2-enoate |
| SMILES | N#COc1ccc(/C=C/C(=O)OCCc2cc(N)cc(N)c2)cc1 |
| InChI | InChI=1S/C18H17N3O3/c19-12-24-17-4-1-13(2-5-17)3-6-18(22)23-8-7-14-9-15(20)11-16(21)10-14/h1-6,9-11H,7-8,20-21H2/b6-3+ |
| InChIKey | IGHCNLATHPRRFK-ZZXKWVIFSA-N |
| XLogP | 2.51 |
| TPSA | 111.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|