C33H32N2O4 — CID 118566208
1-O-[2-(3,5-diaminophenyl)ethyl] 4-O-[4-[4-(4-propylphenyl)phenyl]phenyl] (Z)-but-2-enedioate (PubChem CID 118566208) has the molecular formula C33H32N2O4 and a molecular weight of 520.63 g/mol. Its IUPAC name is 1-O-[2-(3,5-diaminophenyl)ethyl] 4-O-[4-[4-(4-propylphenyl)phenyl]phenyl] (Z)-but-2-enedioate.
| Compound Name | 1-O-[2-(3,5-diaminophenyl)ethyl] 4-O-[4-[4-(4-propylphenyl)phenyl]phenyl] (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 118566208 |
| Molecular Formula | C33H32N2O4 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | 1-O-[2-(3,5-diaminophenyl)ethyl] 4-O-[4-[4-(4-propylphenyl)phenyl]phenyl] (Z)-but-2-enedioate |
| SMILES | CCCc1ccc(-c2ccc(-c3ccc(OC(=O)/C=C\C(=O)OCCc4cc(N)cc(N)c4)cc3)cc2)cc1 |
| InChI | InChI=1S/C33H32N2O4/c1-2-3-23-4-6-25(7-5-23)26-8-10-27(11-9-26)28-12-14-31(15-13-28)39-33(37)17-16-32(36)38-19-18-24-20-29(34)22-30(35)21-24/h4-17,20-22H,2-3,18-19,34-35H2,1H3/b17-16- |
| InChIKey | OVSJFZHRBMSBPY-MSUUIHNZSA-N |
| XLogP | 6.39 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|