C34H44F2N2O5 — CID 89401257
4-[(E)-3-[4-[difluoro-(4-pentyl-1-bicyclo[2.2.2]octanyl)methoxy]phenyl]prop-2-enoyl]oxybutyl 3,5-diaminobenzoate (PubChem CID 89401257) has the molecular formula C34H44F2N2O5 and a molecular weight of 598.73 g/mol. Its IUPAC name is 4-[(E)-3-[4-[difluoro-(4-pentyl-1-bicyclo[2.2.2]octanyl)methoxy]phenyl]prop-2-enoyl]oxybutyl 3,5-diaminobenzoate.
| Compound Name | 4-[(E)-3-[4-[difluoro-(4-pentyl-1-bicyclo[2.2.2]octanyl)methoxy]phenyl]prop-2-enoyl]oxybutyl 3,5-diaminobenzoate |
|---|---|
| PubChem CID | 89401257 |
| Molecular Formula | C34H44F2N2O5 |
| Molecular Weight | 598.73 g/mol |
| Exact Mass | 598.32 |
| IUPAC Name | 4-[(E)-3-[4-[difluoro-(4-pentyl-1-bicyclo[2.2.2]octanyl)methoxy]phenyl]prop-2-enoyl]oxybutyl 3,5-diaminobenzoate |
| SMILES | CCCCCC12CCC(C(F)(F)Oc3ccc(/C=C/C(=O)OCCCCOC(=O)c4cc(N)cc(N)c4)cc3)(CC1)CC2 |
| InChI | InChI=1S/C34H44F2N2O5/c1-2-3-4-13-32-14-17-33(18-15-32,19-16-32)34(35,36)43-29-10-7-25(8-11-29)9-12-30(39)41-20-5-6-21-42-31(40)26-22-27(37)24-28(38)23-26/h7-12,22-24H,2-6,13-21,37-38H2,1H3/b12-9+ |
| InChIKey | SNIHCYXRXJOFTR-FMIVXFBMSA-N |
| XLogP | 7.94 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.73 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|