C33H44O6 — CID 90874273
4-[3-methyl-4-[4-[4-(4-prop-2-enylperoxybutoxy)phenyl]cyclohexyl]phenoxy]butyl prop-2-enoate (PubChem CID 90874273) has the molecular formula C33H44O6 and a molecular weight of 536.71 g/mol. Its IUPAC name is 4-[3-methyl-4-[4-[4-(4-prop-2-enylperoxybutoxy)phenyl]cyclohexyl]phenoxy]butyl prop-2-enoate.
| Compound Name | 4-[3-methyl-4-[4-[4-(4-prop-2-enylperoxybutoxy)phenyl]cyclohexyl]phenoxy]butyl prop-2-enoate |
|---|---|
| PubChem CID | 90874273 |
| Molecular Formula | C33H44O6 |
| Molecular Weight | 536.71 g/mol |
| Exact Mass | 536.31 |
| IUPAC Name | 4-[3-methyl-4-[4-[4-(4-prop-2-enylperoxybutoxy)phenyl]cyclohexyl]phenoxy]butyl prop-2-enoate |
| SMILES | C=CCOOCCCCOc1ccc(C2CCC(c3ccc(OCCCCOC(=O)C=C)cc3C)CC2)cc1 |
| InChI | InChI=1S/C33H44O6/c1-4-20-38-39-24-9-8-21-35-30-16-14-28(15-17-30)27-10-12-29(13-11-27)32-19-18-31(25-26(32)3)36-22-6-7-23-37-33(34)5-2/h4-5,14-19,25,27,29H,1-2,6-13,20-24H2,3H3 |
| InChIKey | KERFGKXJHULWNG-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.71 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|