C36H47FO5 — CID 59063281
6-[4-[2-fluoro-4-(12-prop-2-enylperoxyspiro[5.6]dodecan-3-yl)phenyl]phenoxy]hexyl prop-2-enoate (PubChem CID 59063281) has the molecular formula C36H47FO5 and a molecular weight of 578.77 g/mol. Its IUPAC name is 6-[4-[2-fluoro-4-(12-prop-2-enylperoxyspiro[5.6]dodecan-3-yl)phenyl]phenoxy]hexyl prop-2-enoate.
| Compound Name | 6-[4-[2-fluoro-4-(12-prop-2-enylperoxyspiro[5.6]dodecan-3-yl)phenyl]phenoxy]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 59063281 |
| Molecular Formula | C36H47FO5 |
| Molecular Weight | 578.77 g/mol |
| Exact Mass | 578.34 |
| IUPAC Name | 6-[4-[2-fluoro-4-(12-prop-2-enylperoxyspiro[5.6]dodecan-3-yl)phenyl]phenoxy]hexyl prop-2-enoate |
| SMILES | C=CCOOC1CCCCCC12CCC(c1ccc(-c3ccc(OCCCCCCOC(=O)C=C)cc3)c(F)c1)CC2 |
| InChI | InChI=1S/C36H47FO5/c1-3-24-41-42-34-12-8-7-9-21-36(34)22-19-28(20-23-36)30-15-18-32(33(37)27-30)29-13-16-31(17-14-29)39-25-10-5-6-11-26-40-35(38)4-2/h3-4,13-18,27-28,34H,1-2,5-12,19-26H2 |
| InChIKey | YSASFEZIWWBNKH-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.77 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|