C42H54O10 — CID 134236388
4-O-[4-[4-oxo-4-(3-prop-2-enoyloxybutoxy)butanoyl]oxyphenyl] 1-O-[4-(4-pentylcyclohexyl)phenyl] cyclohexane-1,4-dicarboxylate (PubChem CID 134236388) has the molecular formula C42H54O10 and a molecular weight of 718.88 g/mol. Its IUPAC name is 4-O-[4-[4-oxo-4-(3-prop-2-enoyloxybutoxy)butanoyl]oxyphenyl] 1-O-[4-(4-pentylcyclohexyl)phenyl] cyclohexane-1,4-dicarboxylate.
| Compound Name | 4-O-[4-[4-oxo-4-(3-prop-2-enoyloxybutoxy)butanoyl]oxyphenyl] 1-O-[4-(4-pentylcyclohexyl)phenyl] cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 134236388 |
| Molecular Formula | C42H54O10 |
| Molecular Weight | 718.88 g/mol |
| Exact Mass | 718.37 |
| IUPAC Name | 4-O-[4-[4-oxo-4-(3-prop-2-enoyloxybutoxy)butanoyl]oxyphenyl] 1-O-[4-(4-pentylcyclohexyl)phenyl] cyclohexane-1,4-dicarboxylate |
| SMILES | C=CC(=O)OC(C)CCOC(=O)CCC(=O)Oc1ccc(OC(=O)C2CCC(C(=O)Oc3ccc(C4CCC(CCCCC)CC4)cc3)CC2)cc1 |
| InChI | InChI=1S/C42H54O10/c1-4-6-7-8-30-9-11-31(12-10-30)32-17-19-36(20-18-32)51-41(46)33-13-15-34(16-14-33)42(47)52-37-23-21-35(22-24-37)50-40(45)26-25-39(44)48-28-27-29(3)49-38(43)5-2/h5,17-24,29-31,33-34H,2,4,6-16,25-28H2,1,3H3 |
| InChIKey | DUWGCVPYUVVXML-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.88 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|