C28H36O2 — CID 141004500
7-[4-(4-phenylphenyl)cyclohexyl]heptan-2-yl prop-2-enoate (PubChem CID 141004500) has the molecular formula C28H36O2 and a molecular weight of 404.59 g/mol. Its IUPAC name is 7-[4-(4-phenylphenyl)cyclohexyl]heptan-2-yl prop-2-enoate.
| Compound Name | 7-[4-(4-phenylphenyl)cyclohexyl]heptan-2-yl prop-2-enoate |
|---|---|
| PubChem CID | 141004500 |
| Molecular Formula | C28H36O2 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | 7-[4-(4-phenylphenyl)cyclohexyl]heptan-2-yl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)CCCCCC1CCC(c2ccc(-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C28H36O2/c1-3-28(29)30-22(2)10-6-4-7-11-23-14-16-25(17-15-23)27-20-18-26(19-21-27)24-12-8-5-9-13-24/h3,5,8-9,12-13,18-23,25H,1,4,6-7,10-11,14-17H2,2H3 |
| InChIKey | PDSXTJLIDXKGLV-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|