C27H36O3 — CID 18960161
octan-2-yl 4-[4-(4-hydroxycyclohexyl)phenyl]benzoate (PubChem CID 18960161) has the molecular formula C27H36O3 and a molecular weight of 408.58 g/mol. Its IUPAC name is octan-2-yl 4-[4-(4-hydroxycyclohexyl)phenyl]benzoate.
| Compound Name | octan-2-yl 4-[4-(4-hydroxycyclohexyl)phenyl]benzoate |
|---|---|
| PubChem CID | 18960161 |
| Molecular Formula | C27H36O3 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | octan-2-yl 4-[4-(4-hydroxycyclohexyl)phenyl]benzoate |
| SMILES | CCCCCCC(C)OC(=O)c1ccc(-c2ccc(C3CCC(O)CC3)cc2)cc1 |
| InChI | InChI=1S/C27H36O3/c1-3-4-5-6-7-20(2)30-27(29)25-14-12-23(13-15-25)21-8-10-22(11-9-21)24-16-18-26(28)19-17-24/h8-15,20,24,26,28H,3-7,16-19H2,1-2H3 |
| InChIKey | GLIIUWPQASJWPK-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|