C30H42O7 — CID 164932631
1-O-[4-(4-ethylcyclohexyl)cyclohexyl] 4-O-(4-prop-2-enoyloxybutyl) 2-methoxybenzene-1,4-dicarboxylate (PubChem CID 164932631) has the molecular formula C30H42O7 and a molecular weight of 514.66 g/mol. Its IUPAC name is 1-O-[4-(4-ethylcyclohexyl)cyclohexyl] 4-O-(4-prop-2-enoyloxybutyl) 2-methoxybenzene-1,4-dicarboxylate.
| Compound Name | 1-O-[4-(4-ethylcyclohexyl)cyclohexyl] 4-O-(4-prop-2-enoyloxybutyl) 2-methoxybenzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 164932631 |
| Molecular Formula | C30H42O7 |
| Molecular Weight | 514.66 g/mol |
| Exact Mass | 514.29 |
| IUPAC Name | 1-O-[4-(4-ethylcyclohexyl)cyclohexyl] 4-O-(4-prop-2-enoyloxybutyl) 2-methoxybenzene-1,4-dicarboxylate |
| SMILES | C=CC(=O)OCCCCOC(=O)c1ccc(C(=O)OC2CCC(C3CCC(CC)CC3)CC2)c(OC)c1 |
| InChI | InChI=1S/C30H42O7/c1-4-21-8-10-22(11-9-21)23-12-15-25(16-13-23)37-30(33)26-17-14-24(20-27(26)34-3)29(32)36-19-7-6-18-35-28(31)5-2/h5,14,17,20-23,25H,2,4,6-13,15-16,18-19H2,1,3H3 |
| InChIKey | YGQMEBOSLGNYFI-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.66 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|