C31H46O3 — CID 129146251
[(E)-8-[4-[4-(4-ethylcyclohexyl)cyclohexyl]phenoxy]oct-2-enyl] prop-2-enoate (PubChem CID 129146251) has the molecular formula C31H46O3 and a molecular weight of 466.71 g/mol. Its IUPAC name is [(E)-8-[4-[4-(4-ethylcyclohexyl)cyclohexyl]phenoxy]oct-2-enyl] prop-2-enoate.
| Compound Name | [(E)-8-[4-[4-(4-ethylcyclohexyl)cyclohexyl]phenoxy]oct-2-enyl] prop-2-enoate |
|---|---|
| PubChem CID | 129146251 |
| Molecular Formula | C31H46O3 |
| Molecular Weight | 466.71 g/mol |
| Exact Mass | 466.34 |
| IUPAC Name | [(E)-8-[4-[4-(4-ethylcyclohexyl)cyclohexyl]phenoxy]oct-2-enyl] prop-2-enoate |
| SMILES | C=CC(=O)OC/C=C/CCCCCOc1ccc(C2CCC(C3CCC(CC)CC3)CC2)cc1 |
| InChI | InChI=1S/C31H46O3/c1-3-25-11-13-26(14-12-25)27-15-17-28(18-16-27)29-19-21-30(22-20-29)33-23-9-7-5-6-8-10-24-34-31(32)4-2/h4,8,10,19-22,25-28H,2-3,5-7,9,11-18,23-24H2,1H3/b10-8+ |
| InChIKey | PMBSIOUOIYYJJE-CSKARUKUSA-N |
| XLogP | 8.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.71 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|