C34H46N2O7 — CID 172962445
methane;4-O-[4-methyl-2-[(E)-C-methyl-N-(methylamino)carbonimidoyl]phenyl] 1-O-[4-(6-prop-2-enoyloxyhexoxy)phenyl] cyclohexane-1,4-dicarboxylate (PubChem CID 172962445) has the molecular formula C34H46N2O7 and a molecular weight of 594.75 g/mol. Its IUPAC name is methane;4-O-[4-methyl-2-[(E)-C-methyl-N-(methylamino)carbonimidoyl]phenyl] 1-O-[4-(6-prop-2-enoyloxyhexoxy)phenyl] cyclohexane-1,4-dicarboxylate.
| Compound Name | methane;4-O-[4-methyl-2-[(E)-C-methyl-N-(methylamino)carbonimidoyl]phenyl] 1-O-[4-(6-prop-2-enoyloxyhexoxy)phenyl] cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 172962445 |
| Molecular Formula | C34H46N2O7 |
| Molecular Weight | 594.75 g/mol |
| Exact Mass | 594.33 |
| IUPAC Name | methane;4-O-[4-methyl-2-[(E)-C-methyl-N-(methylamino)carbonimidoyl]phenyl] 1-O-[4-(6-prop-2-enoyloxyhexoxy)phenyl] cyclohexane-1,4-dicarboxylate |
| SMILES | C.C=CC(=O)OCCCCCCOc1ccc(OC(=O)C2CCC(C(=O)Oc3ccc(C)cc3/C(C)=N/NC)CC2)cc1 |
| InChI | InChI=1S/C33H42N2O7.CH4/c1-5-31(36)40-21-9-7-6-8-20-39-27-15-17-28(18-16-27)41-32(37)25-11-13-26(14-12-25)33(38)42-30-19-10-23(2)22-29(30)24(3)35-34-4;/h5,10,15-19,22,25-26,34H,1,6-9,11-14,20-21H2,2-4H3;1H4/b35-24+; |
| InChIKey | VRWAPVSCNQOCFT-DYICZVFTSA-N |
| XLogP | 6.56 |
| TPSA | 112.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.75 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|