C19H30O3 — CID 171873336
1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)butane-1,2,4-triol (PubChem CID 171873336) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is 1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)butane-1,2,4-triol.
| Compound Name | 1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 171873336 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)butane-1,2,4-triol |
| SMILES | Cc1cc2c(cc1C(O)C(O)CCO)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C19H30O3/c1-12-10-14-15(19(4,5)8-7-18(14,2)3)11-13(12)17(22)16(21)6-9-20/h10-11,16-17,20-22H,6-9H2,1-5H3 |
| InChIKey | DJGBJEVPLFOGPU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |