C12H19NO — CID 64812187
3-(2,5-dimethylphenyl)-3-(methylamino)propan-1-ol (PubChem CID 64812187) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 3-(2,5-dimethylphenyl)-3-(methylamino)propan-1-ol.
| Compound Name | 3-(2,5-dimethylphenyl)-3-(methylamino)propan-1-ol |
|---|---|
| PubChem CID | 64812187 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 3-(2,5-dimethylphenyl)-3-(methylamino)propan-1-ol |
| SMILES | CNC(CCO)c1cc(C)ccc1C |
| InChI | InChI=1S/C12H19NO/c1-9-4-5-10(2)11(8-9)12(13-3)6-7-14/h4-5,8,12-14H,6-7H2,1-3H3 |
| InChIKey | QZMBGGZTIGNQLT-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |