C14H23N — CID 43483753
1-(2,5-dimethylphenyl)-N-methylpentan-1-amine (PubChem CID 43483753) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-N-methylpentan-1-amine.
| Compound Name | 1-(2,5-dimethylphenyl)-N-methylpentan-1-amine |
|---|---|
| PubChem CID | 43483753 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-N-methylpentan-1-amine |
| SMILES | CCCCC(NC)c1cc(C)ccc1C |
| InChI | InChI=1S/C14H23N/c1-5-6-7-14(15-4)13-10-11(2)8-9-12(13)3/h8-10,14-15H,5-7H2,1-4H3 |
| InChIKey | DTVBUIZPUNYLNC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |