C14H22O — CID 83050609
2-(2,5-dimethylphenyl)hexan-3-ol (PubChem CID 83050609) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)hexan-3-ol.
| Compound Name | 2-(2,5-dimethylphenyl)hexan-3-ol |
|---|---|
| PubChem CID | 83050609 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 2-(2,5-dimethylphenyl)hexan-3-ol |
| SMILES | CCCC(O)C(C)c1cc(C)ccc1C |
| InChI | InChI=1S/C14H22O/c1-5-6-14(15)12(4)13-9-10(2)7-8-11(13)3/h7-9,12,14-15H,5-6H2,1-4H3 |
| InChIKey | JQAQWRWJXMMLQJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |