C11H12ClN3O4 — CID 171879727
2-(4-azido-1,2-dihydroxybutyl)-3-chlorobenzoic acid (PubChem CID 171879727) has the molecular formula C11H12ClN3O4 and a molecular weight of 285.69 g/mol. Its IUPAC name is 2-(4-azido-1,2-dihydroxybutyl)-3-chlorobenzoic acid.
| Compound Name | 2-(4-azido-1,2-dihydroxybutyl)-3-chlorobenzoic acid |
|---|---|
| PubChem CID | 171879727 |
| Molecular Formula | C11H12ClN3O4 |
| Molecular Weight | 285.69 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 2-(4-azido-1,2-dihydroxybutyl)-3-chlorobenzoic acid |
| SMILES | [N-]=[N+]=NCCC(O)C(O)c1c(Cl)cccc1C(=O)O |
| InChI | InChI=1S/C11H12ClN3O4/c12-7-3-1-2-6(11(18)19)9(7)10(17)8(16)4-5-14-15-13/h1-3,8,10,16-17H,4-5H2,(H,18,19) |
| InChIKey | TXHNOGBMJDIISA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 126.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.69 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|