C8H10F2N2O2S — CID 57344466
1-fluoro-4-[1-fluoro-2-(sulfamoylamino)ethyl]benzene (PubChem CID 57344466) has the molecular formula C8H10F2N2O2S and a molecular weight of 236.24 g/mol. Its IUPAC name is 1-fluoro-4-[1-fluoro-2-(sulfamoylamino)ethyl]benzene.
| Compound Name | 1-fluoro-4-[1-fluoro-2-(sulfamoylamino)ethyl]benzene |
|---|---|
| PubChem CID | 57344466 |
| Molecular Formula | C8H10F2N2O2S |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 1-fluoro-4-[1-fluoro-2-(sulfamoylamino)ethyl]benzene |
| SMILES | NS(=O)(=O)NCC(F)c1ccc(F)cc1 |
| InChI | InChI=1S/C8H10F2N2O2S/c9-7-3-1-6(2-4-7)8(10)5-12-15(11,13)14/h1-4,8,12H,5H2,(H2,11,13,14) |
| InChIKey | CMKBCPISIWJQKK-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |