C12H18N2O3S — CID 171875544
S-[4-(2-amino-5-methyl-3-pyridinyl)-3,4-dihydroxybutyl] ethanethioate (PubChem CID 171875544) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is S-[4-(2-amino-5-methyl-3-pyridinyl)-3,4-dihydroxybutyl] ethanethioate.
| Compound Name | S-[4-(2-amino-5-methyl-3-pyridinyl)-3,4-dihydroxybutyl] ethanethioate |
|---|---|
| PubChem CID | 171875544 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | S-[4-(2-amino-5-methyl-3-pyridinyl)-3,4-dihydroxybutyl] ethanethioate |
| SMILES | CC(=O)SCCC(O)C(O)c1cc(C)cnc1N |
| InChI | InChI=1S/C12H18N2O3S/c1-7-5-9(12(13)14-6-7)11(17)10(16)3-4-18-8(2)15/h5-6,10-11,16-17H,3-4H2,1-2H3,(H2,13,14) |
| InChIKey | MSHVKFKRAQYIDP-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|