About S-[4-(3-amino-5-methyl-2-pyridinyl)-3,4-dihydroxybutyl] ethanethioate
S-[4-(3-amino-5-methyl-2-pyridinyl)-3,4-dihydroxybutyl] ethanethioate (PubChem CID 171875558) has the molecular formula C12H18N2O3S
and a molecular weight of 270.35 g/mol. Its IUPAC name is S-[4-(3-amino-5-methyl-2-pyridinyl)-3,4-dihydroxybutyl] ethanethioate.
Molecular Properties
| Compound Name | S-[4-(3-amino-5-methyl-2-pyridinyl)-3,4-dihydroxybutyl] ethanethioate |
| PubChem CID | 171875558 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | S-[4-(3-amino-5-methyl-2-pyridinyl)-3,4-dihydroxybutyl] ethanethioate |
| SMILES | CC(=O)SCCC(O)C(O)c1ncc(C)cc1N |
| InChI | InChI=1S/C12H18N2O3S/c1-7-5-9(13)11(14-6-7)12(17)10(16)3-4-18-8(2)15/h5-6,10,12,16-17H,3-4,13H2,1-2H3 |
| InChIKey | IYYGSGSRKRCWAQ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[4-(3-amino-5-methyl-2-pyridinyl)-3,4-dihydroxybutyl] ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[4-(3-amino-5-methyl-2-pyridinyl)-3,4-dihydroxybutyl] ethanethioate?
The IUPAC name of S-[4-(3-amino-5-methyl-2-pyridinyl)-3,4-dihydroxybutyl] ethanethioate (CID 171875558) is S-[4-(3-amino-5-methyl-2-pyridinyl)-3,4-dihydroxybutyl] ethanethioate.
What is the SMILES notation for S-[4-(3-amino-5-methyl-2-pyridinyl)-3,4-dihydroxybutyl] ethanethioate?
The canonical SMILES for S-[4-(3-amino-5-methyl-2-pyridinyl)-3,4-dihydroxybutyl] ethanethioate is CC(=O)SCCC(O)C(O)c1ncc(C)cc1N.
What is the InChIKey of S-[4-(3-amino-5-methyl-2-pyridinyl)-3,4-dihydroxybutyl] ethanethioate?
The InChIKey is IYYGSGSRKRCWAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O3S/c1-7-5-9(13)11(14-6-7)12(17)10(16)3-4-18-8(2)15/h5-6,10,12,16-17H,3-4,13H2,1-2H3.
What are the key properties of S-[4-(3-amino-5-methyl-2-pyridinyl)-3,4-dihydroxybutyl] ethanethioate?
S-[4-(3-amino-5-methyl-2-pyridinyl)-3,4-dihydroxybutyl] ethanethioate has a molecular weight of 270.35 g/mol, XLogP of 1.04, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for S-[4-(3-amino-5-methyl-2-pyridinyl)-3,4-dihydroxybutyl] ethanethioate is sourced from PubChem (CID 171875558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).