C13H17NO5S — CID 171876346
methyl 2-(4-acetylsulfanyl-1,2-dihydroxybutyl)pyridine-4-carboxylate (PubChem CID 171876346) has the molecular formula C13H17NO5S and a molecular weight of 299.35 g/mol. Its IUPAC name is methyl 2-(4-acetylsulfanyl-1,2-dihydroxybutyl)pyridine-4-carboxylate.
| Compound Name | methyl 2-(4-acetylsulfanyl-1,2-dihydroxybutyl)pyridine-4-carboxylate |
|---|---|
| PubChem CID | 171876346 |
| Molecular Formula | C13H17NO5S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | methyl 2-(4-acetylsulfanyl-1,2-dihydroxybutyl)pyridine-4-carboxylate |
| SMILES | COC(=O)c1ccnc(C(O)C(O)CCSC(C)=O)c1 |
| InChI | InChI=1S/C13H17NO5S/c1-8(15)20-6-4-11(16)12(17)10-7-9(3-5-14-10)13(18)19-2/h3,5,7,11-12,16-17H,4,6H2,1-2H3 |
| InChIKey | ZLTSFCLVLRTYRB-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|