C9H11NO4 — CID 162911096
methyl 2-[(1R)-1,2-dihydroxyethyl]pyridine-4-carboxylate (PubChem CID 162911096) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is methyl 2-[(1R)-1,2-dihydroxyethyl]pyridine-4-carboxylate.
| Compound Name | methyl 2-[(1R)-1,2-dihydroxyethyl]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 162911096 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | methyl 2-[(1R)-1,2-dihydroxyethyl]pyridine-4-carboxylate |
| SMILES | COC(=O)c1ccnc([C@@H](O)CO)c1 |
| InChI | InChI=1S/C9H11NO4/c1-14-9(13)6-2-3-10-7(4-6)8(12)5-11/h2-4,8,11-12H,5H2,1H3/t8-/m0/s1 |
| InChIKey | AWMXEZQAIYIMKH-QMMMGPOBSA-N |
| XLogP | -0.11 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |