C9H13N3O3 — CID 139997586
ethyl 2-[amino-(hydroxyamino)methyl]pyridine-4-carboxylate (PubChem CID 139997586) has the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. Its IUPAC name is ethyl 2-[amino-(hydroxyamino)methyl]pyridine-4-carboxylate.
| Compound Name | ethyl 2-[amino-(hydroxyamino)methyl]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 139997586 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | ethyl 2-[amino-(hydroxyamino)methyl]pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1ccnc(C(N)NO)c1 |
| InChI | InChI=1S/C9H13N3O3/c1-2-15-9(13)6-3-4-11-7(5-6)8(10)12-14/h3-5,8,12,14H,2,10H2,1H3 |
| InChIKey | YDCMVZNWNXUHHJ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|