C12H16O6S — CID 171875846
methyl 5-(4-acetylsulfanyl-1,2-dihydroxybutyl)furan-2-carboxylate (PubChem CID 171875846) has the molecular formula C12H16O6S and a molecular weight of 288.32 g/mol. Its IUPAC name is methyl 5-(4-acetylsulfanyl-1,2-dihydroxybutyl)furan-2-carboxylate.
| Compound Name | methyl 5-(4-acetylsulfanyl-1,2-dihydroxybutyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 171875846 |
| Molecular Formula | C12H16O6S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | methyl 5-(4-acetylsulfanyl-1,2-dihydroxybutyl)furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(C(O)C(O)CCSC(C)=O)o1 |
| InChI | InChI=1S/C12H16O6S/c1-7(13)19-6-5-8(14)11(15)9-3-4-10(18-9)12(16)17-2/h3-4,8,11,14-15H,5-6H2,1-2H3 |
| InChIKey | RFOPIYMIFNAOAG-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|