C15H23ClN2O4 — CID 170832134
tert-butyl N-[3-(4-amino-2-chloro-3-methylphenyl)-2,3-dihydroxypropyl]carbamate (PubChem CID 170832134) has the molecular formula C15H23ClN2O4 and a molecular weight of 330.81 g/mol. Its IUPAC name is tert-butyl N-[3-(4-amino-2-chloro-3-methylphenyl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | tert-butyl N-[3-(4-amino-2-chloro-3-methylphenyl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 170832134 |
| Molecular Formula | C15H23ClN2O4 |
| Molecular Weight | 330.81 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | tert-butyl N-[3-(4-amino-2-chloro-3-methylphenyl)-2,3-dihydroxypropyl]carbamate |
| SMILES | Cc1c(N)ccc(C(O)C(O)CNC(=O)OC(C)(C)C)c1Cl |
| InChI | InChI=1S/C15H23ClN2O4/c1-8-10(17)6-5-9(12(8)16)13(20)11(19)7-18-14(21)22-15(2,3)4/h5-6,11,13,19-20H,7,17H2,1-4H3,(H,18,21) |
| InChIKey | VRDKLJKLHAJCFX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.81 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|