C13H17NO2S5 — CID 10091137
tert-butyl N-[2-(1,2,3,4,5-benzopentathiepin-6-yl)ethyl]carbamate (PubChem CID 10091137) has the molecular formula C13H17NO2S5 and a molecular weight of 379.62 g/mol. Its IUPAC name is tert-butyl N-[2-(1,2,3,4,5-benzopentathiepin-6-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(1,2,3,4,5-benzopentathiepin-6-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 10091137 |
| Molecular Formula | C13H17NO2S5 |
| Molecular Weight | 379.62 g/mol |
| Exact Mass | 378.99 |
| IUPAC Name | tert-butyl N-[2-(1,2,3,4,5-benzopentathiepin-6-yl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1cccc2c1SSSSS2 |
| InChI | InChI=1S/C13H17NO2S5/c1-13(2,3)16-12(15)14-8-7-9-5-4-6-10-11(9)18-20-21-19-17-10/h4-6H,7-8H2,1-3H3,(H,14,15) |
| InChIKey | VJBIXTRXMXYJOW-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.62 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|