C23H19FN2O6 — CID 139720749
methyl (2S)-3-[4-(4-fluorophenyl)phenyl]-2-[(4-nitrophenoxy)carbonylamino]propanoate (PubChem CID 139720749) has the molecular formula C23H19FN2O6 and a molecular weight of 438.41 g/mol. Its IUPAC name is methyl (2S)-3-[4-(4-fluorophenyl)phenyl]-2-[(4-nitrophenoxy)carbonylamino]propanoate.
| Compound Name | methyl (2S)-3-[4-(4-fluorophenyl)phenyl]-2-[(4-nitrophenoxy)carbonylamino]propanoate |
|---|---|
| PubChem CID | 139720749 |
| Molecular Formula | C23H19FN2O6 |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | methyl (2S)-3-[4-(4-fluorophenyl)phenyl]-2-[(4-nitrophenoxy)carbonylamino]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(-c2ccc(F)cc2)cc1)NC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H19FN2O6/c1-31-22(27)21(25-23(28)32-20-12-10-19(11-13-20)26(29)30)14-15-2-4-16(5-3-15)17-6-8-18(24)9-7-17/h2-13,21H,14H2,1H3,(H,25,28)/t21-/m0/s1 |
| InChIKey | CVBJWYPJTYNWDK-NRFANRHFSA-N |
| XLogP | 4.27 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|