C31H36FN3O7 — CID 140874867
ethyl (2S)-2-[[(2S)-2-(1-adamantyloxycarbonylamino)-3-(4-nitrophenyl)propanoyl]amino]-3-(4-fluorophenyl)propanoate (PubChem CID 140874867) has the molecular formula C31H36FN3O7 and a molecular weight of 581.64 g/mol. Its IUPAC name is ethyl (2S)-2-[[(2S)-2-(1-adamantyloxycarbonylamino)-3-(4-nitrophenyl)propanoyl]amino]-3-(4-fluorophenyl)propanoate.
| Compound Name | ethyl (2S)-2-[[(2S)-2-(1-adamantyloxycarbonylamino)-3-(4-nitrophenyl)propanoyl]amino]-3-(4-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 140874867 |
| Molecular Formula | C31H36FN3O7 |
| Molecular Weight | 581.64 g/mol |
| Exact Mass | 581.25 |
| IUPAC Name | ethyl (2S)-2-[[(2S)-2-(1-adamantyloxycarbonylamino)-3-(4-nitrophenyl)propanoyl]amino]-3-(4-fluorophenyl)propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(F)cc1)NC(=O)[C@H](Cc1ccc([N+](=O)[O-])cc1)NC(=O)OC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C31H36FN3O7/c1-2-41-29(37)27(15-19-3-7-24(32)8-4-19)33-28(36)26(14-20-5-9-25(10-6-20)35(39)40)34-30(38)42-31-16-21-11-22(17-31)13-23(12-21)18-31/h3-10,21-23,26-27H,2,11-18H2,1H3,(H,33,36)(H,34,38)/t21?,22?,23?,26-,27-,31?/m0/s1 |
| InChIKey | KNOKBEMREDUNBB-QHWXWQBDSA-N |
| XLogP | 4.63 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.64 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|