C22H29N3O4 — CID 22173579
methyl 2-(1-adamantyloxycarbonylamino)-3-(4-carbamimidoylphenyl)propanoate (PubChem CID 22173579) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is methyl 2-(1-adamantyloxycarbonylamino)-3-(4-carbamimidoylphenyl)propanoate.
| Compound Name | methyl 2-(1-adamantyloxycarbonylamino)-3-(4-carbamimidoylphenyl)propanoate |
|---|---|
| PubChem CID | 22173579 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | methyl 2-(1-adamantyloxycarbonylamino)-3-(4-carbamimidoylphenyl)propanoate |
| SMILES | [H]/N=C(\N)c1ccc(CC(NC(=O)OC23CC4CC(CC(C4)C2)C3)C(=O)OC)cc1 |
| InChI | InChI=1S/C22H29N3O4/c1-28-20(26)18(9-13-2-4-17(5-3-13)19(23)24)25-21(27)29-22-10-14-6-15(11-22)8-16(7-14)12-22/h2-5,14-16,18H,6-12H2,1H3,(H3,23,24)(H,25,27) |
| InChIKey | KBXRKMKHHBTJAB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 114.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|