C27H33N5O7S2 — CID 22901070
[4-[(2S)-2-[[(2S)-1-(4-carbamimidoylphenyl)sulfonylpyrrolidine-2-carbonyl]amino]-3-methoxy-3-oxopropyl]phenyl] thiomorpholine-4-carboxylate (PubChem CID 22901070) has the molecular formula C27H33N5O7S2 and a molecular weight of 603.72 g/mol. Its IUPAC name is [4-[(2S)-2-[[(2S)-1-(4-carbamimidoylphenyl)sulfonylpyrrolidine-2-carbonyl]amino]-3-methoxy-3-oxopropyl]phenyl] thiomorpholine-4-carboxylate.
| Compound Name | [4-[(2S)-2-[[(2S)-1-(4-carbamimidoylphenyl)sulfonylpyrrolidine-2-carbonyl]amino]-3-methoxy-3-oxopropyl]phenyl] thiomorpholine-4-carboxylate |
|---|---|
| PubChem CID | 22901070 |
| Molecular Formula | C27H33N5O7S2 |
| Molecular Weight | 603.72 g/mol |
| Exact Mass | 603.18 |
| IUPAC Name | [4-[(2S)-2-[[(2S)-1-(4-carbamimidoylphenyl)sulfonylpyrrolidine-2-carbonyl]amino]-3-methoxy-3-oxopropyl]phenyl] thiomorpholine-4-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc(S(=O)(=O)N2CCC[C@H]2C(=O)N[C@@H](Cc2ccc(OC(=O)N3CCSCC3)cc2)C(=O)OC)cc1 |
| InChI | InChI=1S/C27H33N5O7S2/c1-38-26(34)22(17-18-4-8-20(9-5-18)39-27(35)31-13-15-40-16-14-31)30-25(33)23-3-2-12-32(23)41(36,37)21-10-6-19(7-11-21)24(28)29/h4-11,22-23H,2-3,12-17H2,1H3,(H3,28,29)(H,30,33)/t22-,23-/m0/s1 |
| InChIKey | QQDMJMVESSQXRX-GOTSBHOMSA-N |
| XLogP | 1.57 |
| TPSA | 172.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.72 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|